C19H18N3O2PS — CID 165123357
N-(6-dimethylphosphoryl-7-methoxyquinolin-4-yl)-1,3-benzothiazol-5-amine (PubChem CID 165123357) has the molecular formula C19H18N3O2PS and a molecular weight of 383.41 g/mol. Its IUPAC name is N-(6-dimethylphosphoryl-7-methoxyquinolin-4-yl)-1,3-benzothiazol-5-amine.
| Compound Name | N-(6-dimethylphosphoryl-7-methoxyquinolin-4-yl)-1,3-benzothiazol-5-amine |
|---|---|
| PubChem CID | 165123357 |
| Molecular Formula | C19H18N3O2PS |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | N-(6-dimethylphosphoryl-7-methoxyquinolin-4-yl)-1,3-benzothiazol-5-amine |
| SMILES | COc1cc2nccc(Nc3ccc4scnc4c3)c2cc1P(C)(C)=O |
| InChI | InChI=1S/C19H18N3O2PS/c1-24-17-10-15-13(9-18(17)25(2,3)23)14(6-7-20-15)22-12-4-5-19-16(8-12)21-11-26-19/h4-11H,1-3H3,(H,20,22) |
| InChIKey | SCBFIYRRWCWQAT-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|