C22H21N4O2PS — CID 146438260
N-[6-bis(prop-2-enyl)phosphoryl-7-methoxyquinazolin-4-yl]-1,3-benzothiazol-5-amine (PubChem CID 146438260) has the molecular formula C22H21N4O2PS and a molecular weight of 436.48 g/mol. Its IUPAC name is N-[6-bis(prop-2-enyl)phosphoryl-7-methoxyquinazolin-4-yl]-1,3-benzothiazol-5-amine.
| Compound Name | N-[6-bis(prop-2-enyl)phosphoryl-7-methoxyquinazolin-4-yl]-1,3-benzothiazol-5-amine |
|---|---|
| PubChem CID | 146438260 |
| Molecular Formula | C22H21N4O2PS |
| Molecular Weight | 436.48 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | N-[6-bis(prop-2-enyl)phosphoryl-7-methoxyquinazolin-4-yl]-1,3-benzothiazol-5-amine |
| SMILES | C=CCP(=O)(CC=C)c1cc2c(Nc3ccc4scnc4c3)ncnc2cc1OC |
| InChI | InChI=1S/C22H21N4O2PS/c1-4-8-29(27,9-5-2)20-11-16-17(12-19(20)28-3)23-13-24-22(16)26-15-6-7-21-18(10-15)25-14-30-21/h4-7,10-14H,1-2,8-9H2,3H3,(H,23,24,26) |
| InChIKey | FBQDRQAXHVKOFS-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.48 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|