C21H21ClN4O3S2 — CID 89410811
N-[6-tert-butylsulfonyl-7-(2-chloroethoxy)quinazolin-4-yl]-1,3-benzothiazol-5-amine (PubChem CID 89410811) has the molecular formula C21H21ClN4O3S2 and a molecular weight of 477.01 g/mol. Its IUPAC name is N-[6-tert-butylsulfonyl-7-(2-chloroethoxy)quinazolin-4-yl]-1,3-benzothiazol-5-amine.
| Compound Name | N-[6-tert-butylsulfonyl-7-(2-chloroethoxy)quinazolin-4-yl]-1,3-benzothiazol-5-amine |
|---|---|
| PubChem CID | 89410811 |
| Molecular Formula | C21H21ClN4O3S2 |
| Molecular Weight | 477.01 g/mol |
| Exact Mass | 476.07 |
| IUPAC Name | N-[6-tert-butylsulfonyl-7-(2-chloroethoxy)quinazolin-4-yl]-1,3-benzothiazol-5-amine |
| SMILES | CC(C)(C)S(=O)(=O)c1cc2c(Nc3ccc4scnc4c3)ncnc2cc1OCCCl |
| InChI | InChI=1S/C21H21ClN4O3S2/c1-21(2,3)31(27,28)19-9-14-15(10-17(19)29-7-6-22)23-11-24-20(14)26-13-4-5-18-16(8-13)25-12-30-18/h4-5,8-12H,6-7H2,1-3H3,(H,23,24,26) |
| InChIKey | KYIYFJLQVZCDLZ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.01 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|