C27H33N5O5S2 — CID 130421193
2-[4-(1,3-benzothiazol-5-ylamino)-6-tert-butylsulfonylquinazolin-7-yl]oxyethyl (3S)-2-amino-3-methylpentanoate (PubChem CID 130421193) has the molecular formula C27H33N5O5S2 and a molecular weight of 571.73 g/mol. Its IUPAC name is 2-[4-(1,3-benzothiazol-5-ylamino)-6-tert-butylsulfonylquinazolin-7-yl]oxyethyl (3S)-2-amino-3-methylpentanoate.
| Compound Name | 2-[4-(1,3-benzothiazol-5-ylamino)-6-tert-butylsulfonylquinazolin-7-yl]oxyethyl (3S)-2-amino-3-methylpentanoate |
|---|---|
| PubChem CID | 130421193 |
| Molecular Formula | C27H33N5O5S2 |
| Molecular Weight | 571.73 g/mol |
| Exact Mass | 571.19 |
| IUPAC Name | 2-[4-(1,3-benzothiazol-5-ylamino)-6-tert-butylsulfonylquinazolin-7-yl]oxyethyl (3S)-2-amino-3-methylpentanoate |
| SMILES | CC[C@H](C)C(N)C(=O)OCCOc1cc2ncnc(Nc3ccc4scnc4c3)c2cc1S(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C27H33N5O5S2/c1-6-16(2)24(28)26(33)37-10-9-36-21-13-19-18(12-23(21)39(34,35)27(3,4)5)25(30-14-29-19)32-17-7-8-22-20(11-17)31-15-38-22/h7-8,11-16,24H,6,9-10,28H2,1-5H3,(H,29,30,32)/t16-,24?/m0/s1 |
| InChIKey | HAVAQHACANJDTP-FXIRQEPWSA-N |
| XLogP | 4.85 |
| TPSA | 146.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.73 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|