C21H22N4O7S3 — CID 155558771
2-[4-(1,3-benzothiazol-5-ylamino)-6-tert-butylsulfonylquinazolin-7-yl]oxyethyl hydrogen sulfate (PubChem CID 155558771) has the molecular formula C21H22N4O7S3 and a molecular weight of 538.63 g/mol. Its IUPAC name is 2-[4-(1,3-benzothiazol-5-ylamino)-6-tert-butylsulfonylquinazolin-7-yl]oxyethyl hydrogen sulfate.
| Compound Name | 2-[4-(1,3-benzothiazol-5-ylamino)-6-tert-butylsulfonylquinazolin-7-yl]oxyethyl hydrogen sulfate |
|---|---|
| PubChem CID | 155558771 |
| Molecular Formula | C21H22N4O7S3 |
| Molecular Weight | 538.63 g/mol |
| Exact Mass | 538.07 |
| IUPAC Name | 2-[4-(1,3-benzothiazol-5-ylamino)-6-tert-butylsulfonylquinazolin-7-yl]oxyethyl hydrogen sulfate |
| SMILES | CC(C)(C)S(=O)(=O)c1cc2c(Nc3ccc4scnc4c3)ncnc2cc1OCCOS(=O)(=O)O |
| InChI | InChI=1S/C21H22N4O7S3/c1-21(2,3)34(26,27)19-9-14-15(10-17(19)31-6-7-32-35(28,29)30)22-11-23-20(14)25-13-4-5-18-16(8-13)24-12-33-18/h4-5,8-12H,6-7H2,1-3H3,(H,22,23,25)(H,28,29,30) |
| InChIKey | LAQNJLAAEGWNJR-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 157.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.63 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|