C18H17N4O2PS — CID 165123436
N-(6-dimethylphosphoryl-7-methoxycinnolin-4-yl)-1,3-benzothiazol-5-amine (PubChem CID 165123436) has the molecular formula C18H17N4O2PS and a molecular weight of 384.40 g/mol. Its IUPAC name is N-(6-dimethylphosphoryl-7-methoxycinnolin-4-yl)-1,3-benzothiazol-5-amine.
| Compound Name | N-(6-dimethylphosphoryl-7-methoxycinnolin-4-yl)-1,3-benzothiazol-5-amine |
|---|---|
| PubChem CID | 165123436 |
| Molecular Formula | C18H17N4O2PS |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | N-(6-dimethylphosphoryl-7-methoxycinnolin-4-yl)-1,3-benzothiazol-5-amine |
| SMILES | COc1cc2nncc(Nc3ccc4scnc4c3)c2cc1P(C)(C)=O |
| InChI | InChI=1S/C18H17N4O2PS/c1-24-16-8-13-12(7-17(16)25(2,3)23)15(9-20-22-13)21-11-4-5-18-14(6-11)19-10-26-18/h4-10H,1-3H3,(H,21,22) |
| InChIKey | BFSIANWYODIRPT-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|