C16H14ClN3O2 — CID 69368648
N-(2-chlorophenyl)-6,7-dimethoxycinnolin-4-amine (PubChem CID 69368648) has the molecular formula C16H14ClN3O2 and a molecular weight of 315.76 g/mol. Its IUPAC name is N-(2-chlorophenyl)-6,7-dimethoxycinnolin-4-amine.
| Compound Name | N-(2-chlorophenyl)-6,7-dimethoxycinnolin-4-amine |
|---|---|
| PubChem CID | 69368648 |
| Molecular Formula | C16H14ClN3O2 |
| Molecular Weight | 315.76 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | N-(2-chlorophenyl)-6,7-dimethoxycinnolin-4-amine |
| SMILES | COc1cc2nncc(Nc3ccccc3Cl)c2cc1OC |
| InChI | InChI=1S/C16H14ClN3O2/c1-21-15-7-10-13(8-16(15)22-2)20-18-9-14(10)19-12-6-4-3-5-11(12)17/h3-9H,1-2H3,(H,19,20) |
| InChIKey | XYSGGMTZYPREJM-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.76 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |