C18H15Cl2N3O4 — CID 175295327
7-(2-chloroethoxy)-N-(2-chlorophenyl)-6-methoxy-3-nitroquinolin-4-amine (PubChem CID 175295327) has the molecular formula C18H15Cl2N3O4 and a molecular weight of 408.24 g/mol. Its IUPAC name is 7-(2-chloroethoxy)-N-(2-chlorophenyl)-6-methoxy-3-nitroquinolin-4-amine.
| Compound Name | 7-(2-chloroethoxy)-N-(2-chlorophenyl)-6-methoxy-3-nitroquinolin-4-amine |
|---|---|
| PubChem CID | 175295327 |
| Molecular Formula | C18H15Cl2N3O4 |
| Molecular Weight | 408.24 g/mol |
| Exact Mass | 407.04 |
| IUPAC Name | 7-(2-chloroethoxy)-N-(2-chlorophenyl)-6-methoxy-3-nitroquinolin-4-amine |
| SMILES | COc1cc2c(Nc3ccccc3Cl)c([N+](=O)[O-])cnc2cc1OCCCl |
| InChI | InChI=1S/C18H15Cl2N3O4/c1-26-16-8-11-14(9-17(16)27-7-6-19)21-10-15(23(24)25)18(11)22-13-5-3-2-4-12(13)20/h2-5,8-10H,6-7H2,1H3,(H,21,22) |
| InChIKey | USWOSJIKFULFDK-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.24 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|