C23H26N4O6 — CID 149091574
tert-butyl N-[[4-[(6,7-dimethoxy-3-nitroquinolin-4-yl)amino]phenyl]methyl]carbamate (PubChem CID 149091574) has the molecular formula C23H26N4O6 and a molecular weight of 454.48 g/mol. Its IUPAC name is tert-butyl N-[[4-[(6,7-dimethoxy-3-nitroquinolin-4-yl)amino]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-[(6,7-dimethoxy-3-nitroquinolin-4-yl)amino]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 149091574 |
| Molecular Formula | C23H26N4O6 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | tert-butyl N-[[4-[(6,7-dimethoxy-3-nitroquinolin-4-yl)amino]phenyl]methyl]carbamate |
| SMILES | COc1cc2ncc([N+](=O)[O-])c(Nc3ccc(CNC(=O)OC(C)(C)C)cc3)c2cc1OC |
| InChI | InChI=1S/C23H26N4O6/c1-23(2,3)33-22(28)25-12-14-6-8-15(9-7-14)26-21-16-10-19(31-4)20(32-5)11-17(16)24-13-18(21)27(29)30/h6-11,13H,12H2,1-5H3,(H,24,26)(H,25,28) |
| InChIKey | QSMFPWRTJUZIOP-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 124.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|