C19H16F2N3OPS — CID 165123386
N-[7-(difluoromethoxy)-6-dimethylphosphanylquinolin-4-yl]-1,3-benzothiazol-5-amine (PubChem CID 165123386) has the molecular formula C19H16F2N3OPS and a molecular weight of 403.39 g/mol. Its IUPAC name is N-[7-(difluoromethoxy)-6-dimethylphosphanylquinolin-4-yl]-1,3-benzothiazol-5-amine.
| Compound Name | N-[7-(difluoromethoxy)-6-dimethylphosphanylquinolin-4-yl]-1,3-benzothiazol-5-amine |
|---|---|
| PubChem CID | 165123386 |
| Molecular Formula | C19H16F2N3OPS |
| Molecular Weight | 403.39 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | N-[7-(difluoromethoxy)-6-dimethylphosphanylquinolin-4-yl]-1,3-benzothiazol-5-amine |
| SMILES | CP(C)c1cc2c(Nc3ccc4scnc4c3)ccnc2cc1OC(F)F |
| InChI | InChI=1S/C19H16F2N3OPS/c1-26(2)17-8-12-13(5-6-22-14(12)9-16(17)25-19(20)21)24-11-3-4-18-15(7-11)23-10-27-18/h3-10,19H,1-2H3,(H,22,24) |
| InChIKey | KGVPLVLVASNPLQ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.39 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|