C22H17N3O2S2 — CID 156804975
8-(1,3-benzothiazol-5-ylamino)-2-methyl-1-oxo-2-prop-2-enylthieno[2,3-g]quinolin-3-one (PubChem CID 156804975) has the molecular formula C22H17N3O2S2 and a molecular weight of 419.53 g/mol. Its IUPAC name is 8-(1,3-benzothiazol-5-ylamino)-2-methyl-1-oxo-2-prop-2-enylthieno[2,3-g]quinolin-3-one.
| Compound Name | 8-(1,3-benzothiazol-5-ylamino)-2-methyl-1-oxo-2-prop-2-enylthieno[2,3-g]quinolin-3-one |
|---|---|
| PubChem CID | 156804975 |
| Molecular Formula | C22H17N3O2S2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | 8-(1,3-benzothiazol-5-ylamino)-2-methyl-1-oxo-2-prop-2-enylthieno[2,3-g]quinolin-3-one |
| SMILES | C=CCC1(C)C(=O)c2cc3nccc(Nc4ccc5scnc5c4)c3cc2S1=O |
| InChI | InChI=1S/C22H17N3O2S2/c1-3-7-22(2)21(26)15-10-17-14(11-20(15)29(22)27)16(6-8-23-17)25-13-4-5-19-18(9-13)24-12-28-19/h3-6,8-12H,1,7H2,2H3,(H,23,25) |
| InChIKey | LRPIAKPVAVHJNH-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|