C16H13N5OS — CID 171088906
4-N-(1,3-benzothiazol-6-yl)-7-methoxyquinazoline-4,6-diamine (PubChem CID 171088906) has the molecular formula C16H13N5OS and a molecular weight of 323.38 g/mol. Its IUPAC name is 4-N-(1,3-benzothiazol-6-yl)-7-methoxyquinazoline-4,6-diamine.
| Compound Name | 4-N-(1,3-benzothiazol-6-yl)-7-methoxyquinazoline-4,6-diamine |
|---|---|
| PubChem CID | 171088906 |
| Molecular Formula | C16H13N5OS |
| Molecular Weight | 323.38 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 4-N-(1,3-benzothiazol-6-yl)-7-methoxyquinazoline-4,6-diamine |
| SMILES | COc1cc2ncnc(Nc3ccc4ncsc4c3)c2cc1N |
| InChI | InChI=1S/C16H13N5OS/c1-22-14-6-13-10(5-11(14)17)16(19-7-18-13)21-9-2-3-12-15(4-9)23-8-20-12/h2-8H,17H2,1H3,(H,18,19,21) |
| InChIKey | LTCIRAVYRFLWTG-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.38 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|