C16H14FIN4O — CID 129137091
4-N-[4-fluoro-3-(iodomethyl)phenyl]-7-methoxyquinazoline-4,6-diamine (PubChem CID 129137091) has the molecular formula C16H14FIN4O and a molecular weight of 424.22 g/mol. Its IUPAC name is 4-N-[4-fluoro-3-(iodomethyl)phenyl]-7-methoxyquinazoline-4,6-diamine.
| Compound Name | 4-N-[4-fluoro-3-(iodomethyl)phenyl]-7-methoxyquinazoline-4,6-diamine |
|---|---|
| PubChem CID | 129137091 |
| Molecular Formula | C16H14FIN4O |
| Molecular Weight | 424.22 g/mol |
| Exact Mass | 424.02 |
| IUPAC Name | 4-N-[4-fluoro-3-(iodomethyl)phenyl]-7-methoxyquinazoline-4,6-diamine |
| SMILES | COc1cc2ncnc(Nc3ccc(F)c(CI)c3)c2cc1N |
| InChI | InChI=1S/C16H14FIN4O/c1-23-15-6-14-11(5-13(15)19)16(21-8-20-14)22-10-2-3-12(17)9(4-10)7-18/h2-6,8H,7,19H2,1H3,(H,20,21,22) |
| InChIKey | CSTYSIWQYSPTEW-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.22 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|