C8H4N2S — CID 10702104
1,3-benzothiazole-5-carbonitrile (PubChem CID 10702104) has the molecular formula C8H4N2S and a molecular weight of 160.20 g/mol. Its IUPAC name is 1,3-benzothiazole-5-carbonitrile.
| Compound Name | 1,3-benzothiazole-5-carbonitrile |
|---|---|
| PubChem CID | 10702104 |
| Molecular Formula | C8H4N2S |
| Molecular Weight | 160.20 g/mol |
| Exact Mass | 160.01 |
| IUPAC Name | 1,3-benzothiazole-5-carbonitrile |
| SMILES | N#Cc1ccc2scnc2c1 |
| InChI | InChI=1S/C8H4N2S/c9-4-6-1-2-8-7(3-6)10-5-11-8/h1-3,5H |
| InChIKey | KZWJUNXNZGVOOS-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.20 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |