C9H6N2S — CID 129148958
5-methyl-1,3-benzothiazole-6-carbonitrile (PubChem CID 129148958) has the molecular formula C9H6N2S and a molecular weight of 174.23 g/mol. Its IUPAC name is 5-methyl-1,3-benzothiazole-6-carbonitrile.
| Compound Name | 5-methyl-1,3-benzothiazole-6-carbonitrile |
|---|---|
| PubChem CID | 129148958 |
| Molecular Formula | C9H6N2S |
| Molecular Weight | 174.23 g/mol |
| Exact Mass | 174.03 |
| IUPAC Name | 5-methyl-1,3-benzothiazole-6-carbonitrile |
| SMILES | Cc1cc2ncsc2cc1C#N |
| InChI | InChI=1S/C9H6N2S/c1-6-2-8-9(12-5-11-8)3-7(6)4-10/h2-3,5H,1H3 |
| InChIKey | BEHJRNUIKBYIEM-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.23 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |