C9H5N3S — CID 45077795
[1,3]thiazolo[5,4-g]quinoxaline (PubChem CID 45077795) has the molecular formula C9H5N3S and a molecular weight of 187.23 g/mol. Its IUPAC name is [1,3]thiazolo[5,4-g]quinoxaline.
| Compound Name | [1,3]thiazolo[5,4-g]quinoxaline |
|---|---|
| PubChem CID | 45077795 |
| Molecular Formula | C9H5N3S |
| Molecular Weight | 187.23 g/mol |
| Exact Mass | 187.02 |
| IUPAC Name | [1,3]thiazolo[5,4-g]quinoxaline |
| SMILES | c1cnc2cc3scnc3cc2n1 |
| InChI | InChI=1S/C9H5N3S/c1-2-11-7-4-9-8(12-5-13-9)3-6(7)10-1/h1-5H |
| InChIKey | HVYPZZFEMFWDDJ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.23 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |