About 5-bromo-6-chloro-1,3-benzothiazole
5-bromo-6-chloro-1,3-benzothiazole (PubChem CID 162381468) has the molecular formula C7H3BrClNS
and a molecular weight of 248.53 g/mol. Its IUPAC name is 5-bromo-6-chloro-1,3-benzothiazole.
Molecular Properties
| Compound Name | 5-bromo-6-chloro-1,3-benzothiazole |
| PubChem CID | 162381468 |
| Molecular Formula | C7H3BrClNS |
| Molecular Weight | 248.53 g/mol |
| Exact Mass | 246.89 |
| IUPAC Name | 5-bromo-6-chloro-1,3-benzothiazole |
| SMILES | Clc1cc2scnc2cc1Br |
| InChI | InChI=1S/C7H3BrClNS/c8-4-1-6-7(2-5(4)9)11-3-10-6/h1-3H |
| InChIKey | TWAACCVASRMIIM-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.53 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-6-chloro-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-6-chloro-1,3-benzothiazole?
The IUPAC name of 5-bromo-6-chloro-1,3-benzothiazole (CID 162381468) is 5-bromo-6-chloro-1,3-benzothiazole.
What is the SMILES notation for 5-bromo-6-chloro-1,3-benzothiazole?
The canonical SMILES for 5-bromo-6-chloro-1,3-benzothiazole is Clc1cc2scnc2cc1Br.
What is the InChIKey of 5-bromo-6-chloro-1,3-benzothiazole?
The InChIKey is TWAACCVASRMIIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3BrClNS/c8-4-1-6-7(2-5(4)9)11-3-10-6/h1-3H.
What are the key properties of 5-bromo-6-chloro-1,3-benzothiazole?
5-bromo-6-chloro-1,3-benzothiazole has a molecular weight of 248.53 g/mol, XLogP of 3.71, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-6-chloro-1,3-benzothiazole is sourced from PubChem (CID 162381468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).