C9H9BrN2OS — CID 83904080
2-amino-1-(6-bromo-1,3-benzothiazol-5-yl)ethanol (PubChem CID 83904080) has the molecular formula C9H9BrN2OS and a molecular weight of 273.15 g/mol. Its IUPAC name is 2-amino-1-(6-bromo-1,3-benzothiazol-5-yl)ethanol.
| Compound Name | 2-amino-1-(6-bromo-1,3-benzothiazol-5-yl)ethanol |
|---|---|
| PubChem CID | 83904080 |
| Molecular Formula | C9H9BrN2OS |
| Molecular Weight | 273.15 g/mol |
| Exact Mass | 271.96 |
| IUPAC Name | 2-amino-1-(6-bromo-1,3-benzothiazol-5-yl)ethanol |
| SMILES | NCC(O)c1cc2ncsc2cc1Br |
| InChI | InChI=1S/C9H9BrN2OS/c10-6-2-9-7(12-4-14-9)1-5(6)8(13)3-11/h1-2,4,8,13H,3,11H2 |
| InChIKey | ASMIWGYQJLZILH-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.15 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |