About azane;5-methyl-1,3-benzothiazole
azane;5-methyl-1,3-benzothiazole (PubChem CID 174920703) has the molecular formula C8H10N2S
and a molecular weight of 166.25 g/mol. Its IUPAC name is azane;5-methyl-1,3-benzothiazole.
Molecular Properties
| Compound Name | azane;5-methyl-1,3-benzothiazole |
| PubChem CID | 174920703 |
| Molecular Formula | C8H10N2S |
| Molecular Weight | 166.25 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | azane;5-methyl-1,3-benzothiazole |
| SMILES | Cc1ccc2scnc2c1.N |
| InChI | InChI=1S/C8H7NS.H3N/c1-6-2-3-8-7(4-6)9-5-10-8;/h2-5H,1H3;1H3 |
| InChIKey | NANFBLNQHQJWJZ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 47.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.25 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze azane;5-methyl-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;5-methyl-1,3-benzothiazole?
The IUPAC name of azane;5-methyl-1,3-benzothiazole (CID 174920703) is azane;5-methyl-1,3-benzothiazole.
What is the SMILES notation for azane;5-methyl-1,3-benzothiazole?
The canonical SMILES for azane;5-methyl-1,3-benzothiazole is Cc1ccc2scnc2c1.N.
What is the InChIKey of azane;5-methyl-1,3-benzothiazole?
The InChIKey is NANFBLNQHQJWJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NS.H3N/c1-6-2-3-8-7(4-6)9-5-10-8;/h2-5H,1H3;1H3.
What are the key properties of azane;5-methyl-1,3-benzothiazole?
azane;5-methyl-1,3-benzothiazole has a molecular weight of 166.25 g/mol, XLogP of 2.77, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;5-methyl-1,3-benzothiazole is sourced from PubChem (CID 174920703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).