C16H12N2S2 — CID 90688140
3-(1,3-benzothiazol-5-ylmethyl)-5-methyl-1,2-benzothiazole (PubChem CID 90688140) has the molecular formula C16H12N2S2 and a molecular weight of 296.42 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-5-ylmethyl)-5-methyl-1,2-benzothiazole.
| Compound Name | 3-(1,3-benzothiazol-5-ylmethyl)-5-methyl-1,2-benzothiazole |
|---|---|
| PubChem CID | 90688140 |
| Molecular Formula | C16H12N2S2 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 3-(1,3-benzothiazol-5-ylmethyl)-5-methyl-1,2-benzothiazole |
| SMILES | Cc1ccc2snc(Cc3ccc4scnc4c3)c2c1 |
| InChI | InChI=1S/C16H12N2S2/c1-10-2-4-15-12(6-10)13(18-20-15)7-11-3-5-16-14(8-11)17-9-19-16/h2-6,8-9H,7H2,1H3 |
| InChIKey | ABOQCTRRMCHOBS-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |