C9H6N2S — CID 82490527
2-(1,3-benzothiazol-5-yl)acetonitrile (PubChem CID 82490527) has the molecular formula C9H6N2S and a molecular weight of 174.23 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-5-yl)acetonitrile.
| Compound Name | 2-(1,3-benzothiazol-5-yl)acetonitrile |
|---|---|
| PubChem CID | 82490527 |
| Molecular Formula | C9H6N2S |
| Molecular Weight | 174.23 g/mol |
| Exact Mass | 174.03 |
| IUPAC Name | 2-(1,3-benzothiazol-5-yl)acetonitrile |
| SMILES | N#CCc1ccc2scnc2c1 |
| InChI | InChI=1S/C9H6N2S/c10-4-3-7-1-2-9-8(5-7)11-6-12-9/h1-2,5-6H,3H2 |
| InChIKey | MGITWSTWQCJLTA-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.23 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |