C9H5BrN2O — CID 118993763
2-(2-bromo-1,3-benzoxazol-5-yl)acetonitrile (PubChem CID 118993763) has the molecular formula C9H5BrN2O and a molecular weight of 237.06 g/mol. Its IUPAC name is 2-(2-bromo-1,3-benzoxazol-5-yl)acetonitrile.
| Compound Name | 2-(2-bromo-1,3-benzoxazol-5-yl)acetonitrile |
|---|---|
| PubChem CID | 118993763 |
| Molecular Formula | C9H5BrN2O |
| Molecular Weight | 237.06 g/mol |
| Exact Mass | 235.96 |
| IUPAC Name | 2-(2-bromo-1,3-benzoxazol-5-yl)acetonitrile |
| SMILES | N#CCc1ccc2oc(Br)nc2c1 |
| InChI | InChI=1S/C9H5BrN2O/c10-9-12-7-5-6(3-4-11)1-2-8(7)13-9/h1-2,5H,3H2 |
| InChIKey | HZAGJPCPJBUVKQ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.06 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |