C12H13N3O — CID 115230914
3-[(2-methyl-1,3-benzoxazol-5-yl)methylamino]propanenitrile (PubChem CID 115230914) has the molecular formula C12H13N3O and a molecular weight of 215.26 g/mol. Its IUPAC name is 3-[(2-methyl-1,3-benzoxazol-5-yl)methylamino]propanenitrile.
| Compound Name | 3-[(2-methyl-1,3-benzoxazol-5-yl)methylamino]propanenitrile |
|---|---|
| PubChem CID | 115230914 |
| Molecular Formula | C12H13N3O |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 3-[(2-methyl-1,3-benzoxazol-5-yl)methylamino]propanenitrile |
| SMILES | Cc1nc2cc(CNCCC#N)ccc2o1 |
| InChI | InChI=1S/C12H13N3O/c1-9-15-11-7-10(3-4-12(11)16-9)8-14-6-2-5-13/h3-4,7,14H,2,6,8H2,1H3 |
| InChIKey | SOHBVGXCBUTMNI-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|