C11H11NO3 — CID 162219580
carbon dioxide;5-ethyl-2-methyl-1,3-benzoxazole (PubChem CID 162219580) has the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. Its IUPAC name is carbon dioxide;5-ethyl-2-methyl-1,3-benzoxazole.
| Compound Name | carbon dioxide;5-ethyl-2-methyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 162219580 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | carbon dioxide;5-ethyl-2-methyl-1,3-benzoxazole |
| SMILES | CCc1ccc2oc(C)nc2c1.O=C=O |
| InChI | InChI=1S/C10H11NO.CO2/c1-3-8-4-5-10-9(6-8)11-7(2)12-10;2-1-3/h4-6H,3H2,1-2H3; |
| InChIKey | ZTXZYNKZLBNCRI-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |