carbon dioxide;5-ethyl-2-methyl-1,3-benzoxazole

C11H11NO3 — CID 162219580

IUPACcarbon dioxide;5-ethyl-2-methyl-1,3-benzoxazole
SMILESCCc1ccc2oc(C)nc2c1.O=C=O
InChIInChI=1S/C10H11NO.CO2/c1-3-8-4-5-10-9(6-8)11-7(2)12-10;2-1-3/h4-6H,3H2,1-2H3;
InChIKeyZTXZYNKZLBNCRI-UHFFFAOYSA-N
MW205.21 g/mol
LogP2.12
Rot. Bonds1

About carbon dioxide;5-ethyl-2-methyl-1,3-benzoxazole

carbon dioxide;5-ethyl-2-methyl-1,3-benzoxazole (PubChem CID 162219580) has the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. Its IUPAC name is carbon dioxide;5-ethyl-2-methyl-1,3-benzoxazole.

Molecular Properties

Compound Namecarbon dioxide;5-ethyl-2-methyl-1,3-benzoxazole
PubChem CID162219580
Molecular FormulaC11H11NO3
Molecular Weight205.21 g/mol
Exact Mass205.07
IUPAC Namecarbon dioxide;5-ethyl-2-methyl-1,3-benzoxazole
SMILESCCc1ccc2oc(C)nc2c1.O=C=O
InChIInChI=1S/C10H11NO.CO2/c1-3-8-4-5-10-9(6-8)11-7(2)12-10;2-1-3/h4-6H,3H2,1-2H3;
InChIKeyZTXZYNKZLBNCRI-UHFFFAOYSA-N
XLogP2.12
TPSA60.17 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500205.21
LogP ≤ 52.12
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze carbon dioxide;5-ethyl-2-methyl-1,3-benzoxazole with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of carbon dioxide;5-ethyl-2-methyl-1,3-benzoxazole?
The IUPAC name of carbon dioxide;5-ethyl-2-methyl-1,3-benzoxazole (CID 162219580) is carbon dioxide;5-ethyl-2-methyl-1,3-benzoxazole.
What is the SMILES notation for carbon dioxide;5-ethyl-2-methyl-1,3-benzoxazole?
The canonical SMILES for carbon dioxide;5-ethyl-2-methyl-1,3-benzoxazole is CCc1ccc2oc(C)nc2c1.O=C=O.
What is the InChIKey of carbon dioxide;5-ethyl-2-methyl-1,3-benzoxazole?
The InChIKey is ZTXZYNKZLBNCRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO.CO2/c1-3-8-4-5-10-9(6-8)11-7(2)12-10;2-1-3/h4-6H,3H2,1-2H3;.
What are the key properties of carbon dioxide;5-ethyl-2-methyl-1,3-benzoxazole?
carbon dioxide;5-ethyl-2-methyl-1,3-benzoxazole has a molecular weight of 205.21 g/mol, XLogP of 2.12, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;5-ethyl-2-methyl-1,3-benzoxazole is sourced from PubChem (CID 162219580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).