C10H10N2O — CID 143344954
N-[(2-methyl-1,3-benzoxazol-5-yl)methyl]methanimine (PubChem CID 143344954) has the molecular formula C10H10N2O and a molecular weight of 174.20 g/mol. Its IUPAC name is N-[(2-methyl-1,3-benzoxazol-5-yl)methyl]methanimine.
| Compound Name | N-[(2-methyl-1,3-benzoxazol-5-yl)methyl]methanimine |
|---|---|
| PubChem CID | 143344954 |
| Molecular Formula | C10H10N2O |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | N-[(2-methyl-1,3-benzoxazol-5-yl)methyl]methanimine |
| SMILES | C=NCc1ccc2oc(C)nc2c1 |
| InChI | InChI=1S/C10H10N2O/c1-7-12-9-5-8(6-11-2)3-4-10(9)13-7/h3-5H,2,6H2,1H3 |
| InChIKey | SOTZIRBWRJEVEP-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 38.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|