C11H14N2OS — CID 115224002
2-[(2-methyl-1,3-benzoxazol-5-yl)methylamino]ethanethiol (PubChem CID 115224002) has the molecular formula C11H14N2OS and a molecular weight of 222.31 g/mol. Its IUPAC name is 2-[(2-methyl-1,3-benzoxazol-5-yl)methylamino]ethanethiol.
| Compound Name | 2-[(2-methyl-1,3-benzoxazol-5-yl)methylamino]ethanethiol |
|---|---|
| PubChem CID | 115224002 |
| Molecular Formula | C11H14N2OS |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 2-[(2-methyl-1,3-benzoxazol-5-yl)methylamino]ethanethiol |
| SMILES | Cc1nc2cc(CNCCS)ccc2o1 |
| InChI | InChI=1S/C11H14N2OS/c1-8-13-10-6-9(7-12-4-5-15)2-3-11(10)14-8/h2-3,6,12,15H,4-5,7H2,1H3 |
| InChIKey | JULKOZKHDUNYTR-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|