C11H15N3O — CID 115195341
N'-[(2-methyl-1,3-benzoxazol-5-yl)methyl]ethane-1,2-diamine (PubChem CID 115195341) has the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. Its IUPAC name is N'-[(2-methyl-1,3-benzoxazol-5-yl)methyl]ethane-1,2-diamine.
| Compound Name | N'-[(2-methyl-1,3-benzoxazol-5-yl)methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 115195341 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | N'-[(2-methyl-1,3-benzoxazol-5-yl)methyl]ethane-1,2-diamine |
| SMILES | Cc1nc2cc(CNCCN)ccc2o1 |
| InChI | InChI=1S/C11H15N3O/c1-8-14-10-6-9(7-13-5-4-12)2-3-11(10)15-8/h2-3,6,13H,4-5,7,12H2,1H3 |
| InChIKey | UFNWGDPRGYFWFE-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|