C10H8F3NO — CID 116932187
2-methyl-5-(2,2,2-trifluoroethyl)-1,3-benzoxazole (PubChem CID 116932187) has the molecular formula C10H8F3NO and a molecular weight of 215.17 g/mol. Its IUPAC name is 2-methyl-5-(2,2,2-trifluoroethyl)-1,3-benzoxazole.
| Compound Name | 2-methyl-5-(2,2,2-trifluoroethyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 116932187 |
| Molecular Formula | C10H8F3NO |
| Molecular Weight | 215.17 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | 2-methyl-5-(2,2,2-trifluoroethyl)-1,3-benzoxazole |
| SMILES | Cc1nc2cc(CC(F)(F)F)ccc2o1 |
| InChI | InChI=1S/C10H8F3NO/c1-6-14-8-4-7(5-10(11,12)13)2-3-9(8)15-6/h2-4H,5H2,1H3 |
| InChIKey | MTRJEHPFOFSZMP-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.17 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |