C12H10F2N2O — CID 116840933
4,4-difluoro-4-(2-methyl-1,3-benzoxazol-5-yl)butanenitrile (PubChem CID 116840933) has the molecular formula C12H10F2N2O and a molecular weight of 236.22 g/mol. Its IUPAC name is 4,4-difluoro-4-(2-methyl-1,3-benzoxazol-5-yl)butanenitrile.
| Compound Name | 4,4-difluoro-4-(2-methyl-1,3-benzoxazol-5-yl)butanenitrile |
|---|---|
| PubChem CID | 116840933 |
| Molecular Formula | C12H10F2N2O |
| Molecular Weight | 236.22 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 4,4-difluoro-4-(2-methyl-1,3-benzoxazol-5-yl)butanenitrile |
| SMILES | Cc1nc2cc(C(F)(F)CCC#N)ccc2o1 |
| InChI | InChI=1S/C12H10F2N2O/c1-8-16-10-7-9(3-4-11(10)17-8)12(13,14)5-2-6-15/h3-4,7H,2,5H2,1H3 |
| InChIKey | RVUIZAQJQBZZAM-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.22 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |