C15H19F2N — CID 116840925
4-(4-tert-butyl-2-methylphenyl)-4,4-difluorobutanenitrile (PubChem CID 116840925) has the molecular formula C15H19F2N and a molecular weight of 251.32 g/mol. Its IUPAC name is 4-(4-tert-butyl-2-methylphenyl)-4,4-difluorobutanenitrile.
| Compound Name | 4-(4-tert-butyl-2-methylphenyl)-4,4-difluorobutanenitrile |
|---|---|
| PubChem CID | 116840925 |
| Molecular Formula | C15H19F2N |
| Molecular Weight | 251.32 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 4-(4-tert-butyl-2-methylphenyl)-4,4-difluorobutanenitrile |
| SMILES | Cc1cc(C(C)(C)C)ccc1C(F)(F)CCC#N |
| InChI | InChI=1S/C15H19F2N/c1-11-10-12(14(2,3)4)6-7-13(11)15(16,17)8-5-9-18/h6-7,10H,5,8H2,1-4H3 |
| InChIKey | KEPUGYYMQQWEOP-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.32 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |