C12H13F2NO2 — CID 116840847
4-(3,4-dimethoxyphenyl)-4,4-difluorobutanenitrile (PubChem CID 116840847) has the molecular formula C12H13F2NO2 and a molecular weight of 241.24 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)-4,4-difluorobutanenitrile.
| Compound Name | 4-(3,4-dimethoxyphenyl)-4,4-difluorobutanenitrile |
|---|---|
| PubChem CID | 116840847 |
| Molecular Formula | C12H13F2NO2 |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)-4,4-difluorobutanenitrile |
| SMILES | COc1ccc(C(F)(F)CCC#N)cc1OC |
| InChI | InChI=1S/C12H13F2NO2/c1-16-10-5-4-9(8-11(10)17-2)12(13,14)6-3-7-15/h4-5,8H,3,6H2,1-2H3 |
| InChIKey | IRBLPVMRGRULSA-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |