C14H19F3O3 — CID 116535938
2-(3,4-dimethoxyphenyl)-6,6,6-trifluorohexan-2-ol (PubChem CID 116535938) has the molecular formula C14H19F3O3 and a molecular weight of 292.30 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-6,6,6-trifluorohexan-2-ol.
| Compound Name | 2-(3,4-dimethoxyphenyl)-6,6,6-trifluorohexan-2-ol |
|---|---|
| PubChem CID | 116535938 |
| Molecular Formula | C14H19F3O3 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-6,6,6-trifluorohexan-2-ol |
| SMILES | COc1ccc(C(C)(O)CCCC(F)(F)F)cc1OC |
| InChI | InChI=1S/C14H19F3O3/c1-13(18,7-4-8-14(15,16)17)10-5-6-11(19-2)12(9-10)20-3/h5-6,9,18H,4,7-8H2,1-3H3 |
| InChIKey | AJBKSLCIYMYIAF-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |