C12H14ClF3O — CID 115515246
2-(4-chlorophenyl)-6,6,6-trifluorohexan-2-ol (PubChem CID 115515246) has the molecular formula C12H14ClF3O and a molecular weight of 266.69 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-6,6,6-trifluorohexan-2-ol.
| Compound Name | 2-(4-chlorophenyl)-6,6,6-trifluorohexan-2-ol |
|---|---|
| PubChem CID | 115515246 |
| Molecular Formula | C12H14ClF3O |
| Molecular Weight | 266.69 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 2-(4-chlorophenyl)-6,6,6-trifluorohexan-2-ol |
| SMILES | CC(O)(CCCC(F)(F)F)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H14ClF3O/c1-11(17,7-2-8-12(14,15)16)9-3-5-10(13)6-4-9/h3-6,17H,2,7-8H2,1H3 |
| InChIKey | MHEGAGPQCHNCFA-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.69 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |