C13H14F6O — CID 116535882
6,6,6-trifluoro-2-[3-(trifluoromethyl)phenyl]hexan-2-ol (PubChem CID 116535882) has the molecular formula C13H14F6O and a molecular weight of 300.24 g/mol. Its IUPAC name is 6,6,6-trifluoro-2-[3-(trifluoromethyl)phenyl]hexan-2-ol.
| Compound Name | 6,6,6-trifluoro-2-[3-(trifluoromethyl)phenyl]hexan-2-ol |
|---|---|
| PubChem CID | 116535882 |
| Molecular Formula | C13H14F6O |
| Molecular Weight | 300.24 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 6,6,6-trifluoro-2-[3-(trifluoromethyl)phenyl]hexan-2-ol |
| SMILES | CC(O)(CCCC(F)(F)F)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H14F6O/c1-11(20,6-3-7-12(14,15)16)9-4-2-5-10(8-9)13(17,18)19/h2,4-5,8,20H,3,6-7H2,1H3 |
| InChIKey | DSKVMVWKEGHULE-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.24 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |