C13H16BrF3O — CID 116535912
1-(3-bromophenyl)-6,6,6-trifluoro-2-methylhexan-2-ol (PubChem CID 116535912) has the molecular formula C13H16BrF3O and a molecular weight of 325.17 g/mol. Its IUPAC name is 1-(3-bromophenyl)-6,6,6-trifluoro-2-methylhexan-2-ol.
| Compound Name | 1-(3-bromophenyl)-6,6,6-trifluoro-2-methylhexan-2-ol |
|---|---|
| PubChem CID | 116535912 |
| Molecular Formula | C13H16BrF3O |
| Molecular Weight | 325.17 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | 1-(3-bromophenyl)-6,6,6-trifluoro-2-methylhexan-2-ol |
| SMILES | CC(O)(CCCC(F)(F)F)Cc1cccc(Br)c1 |
| InChI | InChI=1S/C13H16BrF3O/c1-12(18,6-3-7-13(15,16)17)9-10-4-2-5-11(14)8-10/h2,4-5,8,18H,3,6-7,9H2,1H3 |
| InChIKey | RSDDEQWSWWHVDI-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.17 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |