C16H26BrN — CID 81032768
4-(3-bromophenyl)-N-tert-butyl-3,3-dimethylbutan-1-amine (PubChem CID 81032768) has the molecular formula C16H26BrN and a molecular weight of 312.29 g/mol. Its IUPAC name is 4-(3-bromophenyl)-N-tert-butyl-3,3-dimethylbutan-1-amine.
| Compound Name | 4-(3-bromophenyl)-N-tert-butyl-3,3-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 81032768 |
| Molecular Formula | C16H26BrN |
| Molecular Weight | 312.29 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 4-(3-bromophenyl)-N-tert-butyl-3,3-dimethylbutan-1-amine |
| SMILES | CC(C)(CCNC(C)(C)C)Cc1cccc(Br)c1 |
| InChI | InChI=1S/C16H26BrN/c1-15(2,3)18-10-9-16(4,5)12-13-7-6-8-14(17)11-13/h6-8,11,18H,9-10,12H2,1-5H3 |
| InChIKey | BNNAIAUEWUSPIL-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.29 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |