C16H26IN — CID 81033423
N-tert-butyl-4-(4-iodophenyl)-3,3-dimethylbutan-1-amine (PubChem CID 81033423) has the molecular formula C16H26IN and a molecular weight of 359.30 g/mol. Its IUPAC name is N-tert-butyl-4-(4-iodophenyl)-3,3-dimethylbutan-1-amine.
| Compound Name | N-tert-butyl-4-(4-iodophenyl)-3,3-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 81033423 |
| Molecular Formula | C16H26IN |
| Molecular Weight | 359.30 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | N-tert-butyl-4-(4-iodophenyl)-3,3-dimethylbutan-1-amine |
| SMILES | CC(C)(CCNC(C)(C)C)Cc1ccc(I)cc1 |
| InChI | InChI=1S/C16H26IN/c1-15(2,3)18-11-10-16(4,5)12-13-6-8-14(17)9-7-13/h6-9,18H,10-12H2,1-5H3 |
| InChIKey | RMAXDFJIKSEQGQ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.30 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|