C12H16INO2 — CID 69036950
[3-(4-iodophenyl)-2,2-dimethylpropyl]carbamic acid (PubChem CID 69036950) has the molecular formula C12H16INO2 and a molecular weight of 333.17 g/mol. Its IUPAC name is [3-(4-iodophenyl)-2,2-dimethylpropyl]carbamic acid.
| Compound Name | [3-(4-iodophenyl)-2,2-dimethylpropyl]carbamic acid |
|---|---|
| PubChem CID | 69036950 |
| Molecular Formula | C12H16INO2 |
| Molecular Weight | 333.17 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | [3-(4-iodophenyl)-2,2-dimethylpropyl]carbamic acid |
| SMILES | CC(C)(CNC(=O)O)Cc1ccc(I)cc1 |
| InChI | InChI=1S/C12H16INO2/c1-12(2,8-14-11(15)16)7-9-3-5-10(13)6-4-9/h3-6,14H,7-8H2,1-2H3,(H,15,16) |
| InChIKey | WUHACNVEIMIDJS-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.17 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|