C13H20N2O — CID 20825966
[2,2-dimethyl-3-(4-methylphenyl)propyl]urea (PubChem CID 20825966) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is [2,2-dimethyl-3-(4-methylphenyl)propyl]urea.
| Compound Name | [2,2-dimethyl-3-(4-methylphenyl)propyl]urea |
|---|---|
| PubChem CID | 20825966 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | [2,2-dimethyl-3-(4-methylphenyl)propyl]urea |
| SMILES | Cc1ccc(CC(C)(C)CNC(N)=O)cc1 |
| InChI | InChI=1S/C13H20N2O/c1-10-4-6-11(7-5-10)8-13(2,3)9-15-12(14)16/h4-7H,8-9H2,1-3H3,(H3,14,15,16) |
| InChIKey | FVWSFSXZAFULDY-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |