About 4-[2,2-dimethyl-3-(4-methylphenyl)propyl]aniline
4-[2,2-dimethyl-3-(4-methylphenyl)propyl]aniline (PubChem CID 170390648) has the molecular formula C18H23N
and a molecular weight of 253.39 g/mol. Its IUPAC name is 4-[2,2-dimethyl-3-(4-methylphenyl)propyl]aniline.
Molecular Properties
| Compound Name | 4-[2,2-dimethyl-3-(4-methylphenyl)propyl]aniline |
| PubChem CID | 170390648 |
| Molecular Formula | C18H23N |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 4-[2,2-dimethyl-3-(4-methylphenyl)propyl]aniline |
| SMILES | Cc1ccc(CC(C)(C)Cc2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C18H23N/c1-14-4-6-15(7-5-14)12-18(2,3)13-16-8-10-17(19)11-9-16/h4-11H,12-13,19H2,1-3H3 |
| InChIKey | CBLXLMWDGREQSP-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[2,2-dimethyl-3-(4-methylphenyl)propyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2,2-dimethyl-3-(4-methylphenyl)propyl]aniline?
The IUPAC name of 4-[2,2-dimethyl-3-(4-methylphenyl)propyl]aniline (CID 170390648) is 4-[2,2-dimethyl-3-(4-methylphenyl)propyl]aniline.
What is the SMILES notation for 4-[2,2-dimethyl-3-(4-methylphenyl)propyl]aniline?
The canonical SMILES for 4-[2,2-dimethyl-3-(4-methylphenyl)propyl]aniline is Cc1ccc(CC(C)(C)Cc2ccc(N)cc2)cc1.
What is the InChIKey of 4-[2,2-dimethyl-3-(4-methylphenyl)propyl]aniline?
The InChIKey is CBLXLMWDGREQSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23N/c1-14-4-6-15(7-5-14)12-18(2,3)13-16-8-10-17(19)11-9-16/h4-11H,12-13,19H2,1-3H3.
What are the key properties of 4-[2,2-dimethyl-3-(4-methylphenyl)propyl]aniline?
4-[2,2-dimethyl-3-(4-methylphenyl)propyl]aniline has a molecular weight of 253.39 g/mol, XLogP of 4.39, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2,2-dimethyl-3-(4-methylphenyl)propyl]aniline is sourced from PubChem (CID 170390648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).