C14H21Br — CID 64716858
1-(4-bromo-2,2-dimethylpentyl)-4-methylbenzene (PubChem CID 64716858) has the molecular formula C14H21Br and a molecular weight of 269.23 g/mol. Its IUPAC name is 1-(4-bromo-2,2-dimethylpentyl)-4-methylbenzene.
| Compound Name | 1-(4-bromo-2,2-dimethylpentyl)-4-methylbenzene |
|---|---|
| PubChem CID | 64716858 |
| Molecular Formula | C14H21Br |
| Molecular Weight | 269.23 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 1-(4-bromo-2,2-dimethylpentyl)-4-methylbenzene |
| SMILES | Cc1ccc(CC(C)(C)CC(C)Br)cc1 |
| InChI | InChI=1S/C14H21Br/c1-11-5-7-13(8-6-11)10-14(3,4)9-12(2)15/h5-8,12H,9-10H2,1-4H3 |
| InChIKey | IETHDJHXBSJGPM-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.23 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|