C13H14BrF3O2 — CID 115514742
2-[(3-bromophenyl)methyl]-6,6,6-trifluorohexanoic acid (PubChem CID 115514742) has the molecular formula C13H14BrF3O2 and a molecular weight of 339.15 g/mol. Its IUPAC name is 2-[(3-bromophenyl)methyl]-6,6,6-trifluorohexanoic acid.
| Compound Name | 2-[(3-bromophenyl)methyl]-6,6,6-trifluorohexanoic acid |
|---|---|
| PubChem CID | 115514742 |
| Molecular Formula | C13H14BrF3O2 |
| Molecular Weight | 339.15 g/mol |
| Exact Mass | 338.01 |
| IUPAC Name | 2-[(3-bromophenyl)methyl]-6,6,6-trifluorohexanoic acid |
| SMILES | O=C(O)C(CCCC(F)(F)F)Cc1cccc(Br)c1 |
| InChI | InChI=1S/C13H14BrF3O2/c14-11-5-1-3-9(8-11)7-10(12(18)19)4-2-6-13(15,16)17/h1,3,5,8,10H,2,4,6-7H2,(H,18,19) |
| InChIKey | DGHZZJYVAQASRA-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.15 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |