2-[(3-bromophenyl)methyl]-6,6,6-trifluorohexanoic acid

C13H14BrF3O2 — CID 115514742

IUPAC2-[(3-bromophenyl)methyl]-6,6,6-trifluorohexanoic acid
SMILESO=C(O)C(CCCC(F)(F)F)Cc1cccc(Br)c1
InChIInChI=1S/C13H14BrF3O2/c14-11-5-1-3-9(8-11)7-10(12(18)19)4-2-6-13(15,16)17/h1,3,5,8,10H,2,4,6-7H2,(H,18,19)
InChIKeyDGHZZJYVAQASRA-UHFFFAOYSA-N
MW339.15 g/mol
LogP4.43
Rot. Bonds6

About 2-[(3-bromophenyl)methyl]-6,6,6-trifluorohexanoic acid

2-[(3-bromophenyl)methyl]-6,6,6-trifluorohexanoic acid (PubChem CID 115514742) has the molecular formula C13H14BrF3O2 and a molecular weight of 339.15 g/mol. Its IUPAC name is 2-[(3-bromophenyl)methyl]-6,6,6-trifluorohexanoic acid.

Molecular Properties

Compound Name2-[(3-bromophenyl)methyl]-6,6,6-trifluorohexanoic acid
PubChem CID115514742
Molecular FormulaC13H14BrF3O2
Molecular Weight339.15 g/mol
Exact Mass338.01
IUPAC Name2-[(3-bromophenyl)methyl]-6,6,6-trifluorohexanoic acid
SMILESO=C(O)C(CCCC(F)(F)F)Cc1cccc(Br)c1
InChIInChI=1S/C13H14BrF3O2/c14-11-5-1-3-9(8-11)7-10(12(18)19)4-2-6-13(15,16)17/h1,3,5,8,10H,2,4,6-7H2,(H,18,19)
InChIKeyDGHZZJYVAQASRA-UHFFFAOYSA-N
XLogP4.43
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500339.15
LogP ≤ 54.43
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 2-[(3-bromophenyl)methyl]-6,6,6-trifluorohexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(3-bromophenyl)methyl]-6,6,6-trifluorohexanoic acid?
The IUPAC name of 2-[(3-bromophenyl)methyl]-6,6,6-trifluorohexanoic acid (CID 115514742) is 2-[(3-bromophenyl)methyl]-6,6,6-trifluorohexanoic acid.
What is the SMILES notation for 2-[(3-bromophenyl)methyl]-6,6,6-trifluorohexanoic acid?
The canonical SMILES for 2-[(3-bromophenyl)methyl]-6,6,6-trifluorohexanoic acid is O=C(O)C(CCCC(F)(F)F)Cc1cccc(Br)c1.
What is the InChIKey of 2-[(3-bromophenyl)methyl]-6,6,6-trifluorohexanoic acid?
The InChIKey is DGHZZJYVAQASRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14BrF3O2/c14-11-5-1-3-9(8-11)7-10(12(18)19)4-2-6-13(15,16)17/h1,3,5,8,10H,2,4,6-7H2,(H,18,19).
What are the key properties of 2-[(3-bromophenyl)methyl]-6,6,6-trifluorohexanoic acid?
2-[(3-bromophenyl)methyl]-6,6,6-trifluorohexanoic acid has a molecular weight of 339.15 g/mol, XLogP of 4.43, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-bromophenyl)methyl]-6,6,6-trifluorohexanoic acid is sourced from PubChem (CID 115514742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).