C12H12BrF3O3 — CID 79418071
2-[(3-bromophenyl)methyl]-5,5,5-trifluoro-4-hydroxypentanoic acid (PubChem CID 79418071) has the molecular formula C12H12BrF3O3 and a molecular weight of 341.12 g/mol. Its IUPAC name is 2-[(3-bromophenyl)methyl]-5,5,5-trifluoro-4-hydroxypentanoic acid.
| Compound Name | 2-[(3-bromophenyl)methyl]-5,5,5-trifluoro-4-hydroxypentanoic acid |
|---|---|
| PubChem CID | 79418071 |
| Molecular Formula | C12H12BrF3O3 |
| Molecular Weight | 341.12 g/mol |
| Exact Mass | 339.99 |
| IUPAC Name | 2-[(3-bromophenyl)methyl]-5,5,5-trifluoro-4-hydroxypentanoic acid |
| SMILES | O=C(O)C(Cc1cccc(Br)c1)CC(O)C(F)(F)F |
| InChI | InChI=1S/C12H12BrF3O3/c13-9-3-1-2-7(5-9)4-8(11(18)19)6-10(17)12(14,15)16/h1-3,5,8,10,17H,4,6H2,(H,18,19) |
| InChIKey | NXACSBVXWXOGKZ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.12 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |