C18H17BrO2 — CID 79422063
2-[(3-bromophenyl)methyl]-5-phenylpent-4-enoic acid (PubChem CID 79422063) has the molecular formula C18H17BrO2 and a molecular weight of 345.24 g/mol. Its IUPAC name is 2-[(3-bromophenyl)methyl]-5-phenylpent-4-enoic acid.
| Compound Name | 2-[(3-bromophenyl)methyl]-5-phenylpent-4-enoic acid |
|---|---|
| PubChem CID | 79422063 |
| Molecular Formula | C18H17BrO2 |
| Molecular Weight | 345.24 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | 2-[(3-bromophenyl)methyl]-5-phenylpent-4-enoic acid |
| SMILES | O=C(O)C(CC=Cc1ccccc1)Cc1cccc(Br)c1 |
| InChI | InChI=1S/C18H17BrO2/c19-17-11-5-9-15(13-17)12-16(18(20)21)10-4-8-14-6-2-1-3-7-14/h1-9,11,13,16H,10,12H2,(H,20,21) |
| InChIKey | YWWMURRCEPBTFW-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.24 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |