C13H15ClF4O — CID 116535931
1-(2-chloro-3-fluorophenyl)-6,6,6-trifluoro-2-methylhexan-2-ol (PubChem CID 116535931) has the molecular formula C13H15ClF4O and a molecular weight of 298.71 g/mol. Its IUPAC name is 1-(2-chloro-3-fluorophenyl)-6,6,6-trifluoro-2-methylhexan-2-ol.
| Compound Name | 1-(2-chloro-3-fluorophenyl)-6,6,6-trifluoro-2-methylhexan-2-ol |
|---|---|
| PubChem CID | 116535931 |
| Molecular Formula | C13H15ClF4O |
| Molecular Weight | 298.71 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 1-(2-chloro-3-fluorophenyl)-6,6,6-trifluoro-2-methylhexan-2-ol |
| SMILES | CC(O)(CCCC(F)(F)F)Cc1cccc(F)c1Cl |
| InChI | InChI=1S/C13H15ClF4O/c1-12(19,6-3-7-13(16,17)18)8-9-4-2-5-10(15)11(9)14/h2,4-5,19H,3,6-8H2,1H3 |
| InChIKey | ZBMKXAPMIITUSN-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.71 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |