C14H21ClFNO — CID 112654826
1-(2-chloro-3-fluorophenyl)-2-methyl-3-(2-methylpropylamino)propan-2-ol (PubChem CID 112654826) has the molecular formula C14H21ClFNO and a molecular weight of 273.78 g/mol. Its IUPAC name is 1-(2-chloro-3-fluorophenyl)-2-methyl-3-(2-methylpropylamino)propan-2-ol.
| Compound Name | 1-(2-chloro-3-fluorophenyl)-2-methyl-3-(2-methylpropylamino)propan-2-ol |
|---|---|
| PubChem CID | 112654826 |
| Molecular Formula | C14H21ClFNO |
| Molecular Weight | 273.78 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 1-(2-chloro-3-fluorophenyl)-2-methyl-3-(2-methylpropylamino)propan-2-ol |
| SMILES | CC(C)CNCC(C)(O)Cc1cccc(F)c1Cl |
| InChI | InChI=1S/C14H21ClFNO/c1-10(2)8-17-9-14(3,18)7-11-5-4-6-12(16)13(11)15/h4-6,10,17-18H,7-9H2,1-3H3 |
| InChIKey | BFHOISGHZZUCNK-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.78 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |