C9H6ClF3O2 — CID 162738183
3-(2-chloro-3-fluorophenyl)-2,2-difluoropropanoic acid (PubChem CID 162738183) has the molecular formula C9H6ClF3O2 and a molecular weight of 238.59 g/mol. Its IUPAC name is 3-(2-chloro-3-fluorophenyl)-2,2-difluoropropanoic acid.
| Compound Name | 3-(2-chloro-3-fluorophenyl)-2,2-difluoropropanoic acid |
|---|---|
| PubChem CID | 162738183 |
| Molecular Formula | C9H6ClF3O2 |
| Molecular Weight | 238.59 g/mol |
| Exact Mass | 238.00 |
| IUPAC Name | 3-(2-chloro-3-fluorophenyl)-2,2-difluoropropanoic acid |
| SMILES | O=C(O)C(F)(F)Cc1cccc(F)c1Cl |
| InChI | InChI=1S/C9H6ClF3O2/c10-7-5(2-1-3-6(7)11)4-9(12,13)8(14)15/h1-3H,4H2,(H,14,15) |
| InChIKey | DXPOGXASMGHCHB-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.59 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |