C24H17F9 — CID 158487114
1-[1,1-bis[3-(trifluoromethyl)phenyl]propyl]-3-(trifluoromethyl)benzene (PubChem CID 158487114) has the molecular formula C24H17F9 and a molecular weight of 476.38 g/mol. Its IUPAC name is 1-[1,1-bis[3-(trifluoromethyl)phenyl]propyl]-3-(trifluoromethyl)benzene.
| Compound Name | 1-[1,1-bis[3-(trifluoromethyl)phenyl]propyl]-3-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 158487114 |
| Molecular Formula | C24H17F9 |
| Molecular Weight | 476.38 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | 1-[1,1-bis[3-(trifluoromethyl)phenyl]propyl]-3-(trifluoromethyl)benzene |
| SMILES | CCC(c1cccc(C(F)(F)F)c1)(c1cccc(C(F)(F)F)c1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H17F9/c1-2-21(15-6-3-9-18(12-15)22(25,26)27,16-7-4-10-19(13-16)23(28,29)30)17-8-5-11-20(14-17)24(31,32)33/h3-14H,2H2,1H3 |
| InChIKey | DOHNCCLYBBVHTF-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.38 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|