About 1-(1,1,2-trifluoroethyl)-3-(trifluoromethyl)benzene
1-(1,1,2-trifluoroethyl)-3-(trifluoromethyl)benzene (PubChem CID 141060662) has the molecular formula C9H6F6
and a molecular weight of 228.14 g/mol. Its IUPAC name is 1-(1,1,2-trifluoroethyl)-3-(trifluoromethyl)benzene.
Analyze 1-(1,1,2-trifluoroethyl)-3-(trifluoromethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,1,2-trifluoroethyl)-3-(trifluoromethyl)benzene?
The IUPAC name of 1-(1,1,2-trifluoroethyl)-3-(trifluoromethyl)benzene (CID 141060662) is 1-(1,1,2-trifluoroethyl)-3-(trifluoromethyl)benzene.
What is the SMILES notation for 1-(1,1,2-trifluoroethyl)-3-(trifluoromethyl)benzene?
The canonical SMILES for 1-(1,1,2-trifluoroethyl)-3-(trifluoromethyl)benzene is FCC(F)(F)c1cccc(C(F)(F)F)c1.
What is the InChIKey of 1-(1,1,2-trifluoroethyl)-3-(trifluoromethyl)benzene?
The InChIKey is NLLLXEDUSFCPAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6F6/c10-5-8(11,12)6-2-1-3-7(4-6)9(13,14)15/h1-4H,5H2.
What are the key properties of 1-(1,1,2-trifluoroethyl)-3-(trifluoromethyl)benzene?
1-(1,1,2-trifluoroethyl)-3-(trifluoromethyl)benzene has a molecular weight of 228.14 g/mol, XLogP of 3.77, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,1,2-trifluoroethyl)-3-(trifluoromethyl)benzene is sourced from PubChem (CID 141060662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).