C10H9F3O — CID 70664342
1-[3-(1,1,2-trifluoroethyl)phenyl]ethanone (PubChem CID 70664342) has the molecular formula C10H9F3O and a molecular weight of 202.17 g/mol. Its IUPAC name is 1-[3-(1,1,2-trifluoroethyl)phenyl]ethanone.
| Compound Name | 1-[3-(1,1,2-trifluoroethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 70664342 |
| Molecular Formula | C10H9F3O |
| Molecular Weight | 202.17 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | 1-[3-(1,1,2-trifluoroethyl)phenyl]ethanone |
| SMILES | CC(=O)c1cccc(C(F)(F)CF)c1 |
| InChI | InChI=1S/C10H9F3O/c1-7(14)8-3-2-4-9(5-8)10(12,13)6-11/h2-5H,6H2,1H3 |
| InChIKey | DAIHTHUJXOVLIN-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.17 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |